Acesulfame potassium

Formula:
C4H5KNO4S
CAS Number(s):
55589-62-3
SMILES code:

[K+].O=C1C=C(C)OS(=O)(=O)[N-]1

Source:
Pharm Eu 6.2