Aceclofenac

Formula:
C16H13Cl2NO4
CAS Number(s):
89796-99-6
SMILES code:

OC(=O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl

Source:
Pharm Eu 6.2