Acebutolol hydrochloride

Formula:
C18H29ClN2O4
CAS Number(s):
34381-68-5
SMILES code:

Cl.CCCC(=O)Nc1ccc(OCC(O)CNC(C)C)c(c1)C(=O)C

Source:
Pharm Eu 6.2