Acamprosate calcium

Formula:
C10H20CaN2O8S2
CAS Number(s):
77337-73-6
SMILES code:

CC(=O)NCCCS(=O)(=O)O[Ca]OS(=O)(=O)CCCNC(=O)C

Source:
Pharm Eu 6.2